2-(2-Aminobenzoyl)pyridine
Chinese name: 2-(2-aminobenzoyl)pyridine, foreign name (2-aminophenyl)(pyridin-2-yl), methanoneCAS No42471-56-7, molecular weight: 198.2206, molecular formula: C12H10N2OSmilesC1=CN=C(C=C1)C(=O)C2=C(N)C=CC=C2
Chinese aliases:
(2-Aminophenyl)(pyridine-2-yl)methanone; (2-Aminophenyl)pyridin-2-ylmethanone
Experimental characteristics
LogP2.47600
PSA55.98000
Melting point 153-155°C
Density 1.215
Calculate the characteristics
Exact molecular weight 198.07900
Number of hydrogen bonded donors 1
Number of hydrogen bond receptors 3
Number of rotatable chemical bonds 2
Number of heavy atoms 15
Complexity 230
Number of isotope atoms 0
Determine the number of atomic stereoscopic centers 0
The number of atomic stereoscopic centers is uncertain 0
Determine the number of chemical bond stereotactic centers 0
The number of chemical bond stereotactic centers is uncertain 0
Number of covalent bond units 1
Hydrophobic parameters calculation reference value (XlogP) None
Number of tautomers 5
Surface charge 0



